C12H18N2 — CID 142263994
6,6-dimethyl-1H-cyclohepta[d]imidazole;ethane (PubChem CID 142263994) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 6,6-dimethyl-1H-cyclohepta[d]imidazole;ethane.
| Compound Name | 6,6-dimethyl-1H-cyclohepta[d]imidazole;ethane |
|---|---|
| PubChem CID | 142263994 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 6,6-dimethyl-1H-cyclohepta[d]imidazole;ethane |
| SMILES | CC.CC1(C)C=Cc2nc[nH]c2C=C1 |
| InChI | InChI=1S/C10H12N2.C2H6/c1-10(2)5-3-8-9(4-6-10)12-7-11-8;1-2/h3-7H,1-2H3,(H,11,12);1-2H3 |
| InChIKey | KWNRYGCVGZSGFM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |