C32H50O5 — CID 142281276
2-(hydroxymethyl)prop-2-enal;5-methoxy-3-[[4-[4-[(E)-pent-3-enyl]phenyl]cyclohexyl]methyl]pentan-1-ol;2-methylprop-2-enal (PubChem CID 142281276) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 2-(hydroxymethyl)prop-2-enal;5-methoxy-3-[[4-[4-[(E)-pent-3-enyl]phenyl]cyclohexyl]methyl]pentan-1-ol;2-methylprop-2-enal.
| Compound Name | 2-(hydroxymethyl)prop-2-enal;5-methoxy-3-[[4-[4-[(E)-pent-3-enyl]phenyl]cyclohexyl]methyl]pentan-1-ol;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142281276 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 2-(hydroxymethyl)prop-2-enal;5-methoxy-3-[[4-[4-[(E)-pent-3-enyl]phenyl]cyclohexyl]methyl]pentan-1-ol;2-methylprop-2-enal |
| SMILES | C/C=C/CCc1ccc(C2CCC(CC(CCO)CCOC)CC2)cc1.C=C(C)C=O.C=C(C=O)CO |
| InChI | InChI=1S/C24H38O2.C4H6O2.C4H6O/c1-3-4-5-6-20-7-11-23(12-8-20)24-13-9-21(10-14-24)19-22(15-17-25)16-18-26-2;1-4(2-5)3-6;1-4(2)3-5/h3-4,7-8,11-12,21-22,24-25H,5-6,9-10,13-19H2,1-2H3;2,6H,1,3H2;3H,1H2,2H3/b4-3+;; |
| InChIKey | BHDIGHUYBOOZJS-CZEFNJPISA-N |
| XLogP | 6.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|