C26H36BN3O2 — CID 142309000
N,N-dimethyl-4-[2-[9-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-1,3-diazonin-4-yl]ethynyl]aniline;ethane (PubChem CID 142309000) has the molecular formula C26H36BN3O2 and a molecular weight of 433.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[9-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-1,3-diazonin-4-yl]ethynyl]aniline;ethane.
| Compound Name | N,N-dimethyl-4-[2-[9-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-1,3-diazonin-4-yl]ethynyl]aniline;ethane |
|---|---|
| PubChem CID | 142309000 |
| Molecular Formula | C26H36BN3O2 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | N,N-dimethyl-4-[2-[9-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-1,3-diazonin-4-yl]ethynyl]aniline;ethane |
| SMILES | CC.Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc(C#Cc2ccc(N(C)C)cc2)nc[nH]1 |
| InChI | InChI=1S/C24H30BN3O2.C2H6/c1-18-16-20(25-29-23(2,3)24(4,5)30-25)11-13-21(27-17-26-18)12-8-19-9-14-22(15-10-19)28(6)7;1-2/h9-11,13-17H,1-7H3,(H,26,27);1-2H3/b18-16-,20-11+,21-13-; |
| InChIKey | IAPCFGYTOHVCRM-UETRYWERSA-N |
| XLogP | 4.63 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|