C24H28F3N3OS — CID 142385644
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[3-[dimethylidene-[4-(trifluoromethyl)anilino]-λ6-sulfanyl]phenyl]methanone (PubChem CID 142385644) has the molecular formula C24H28F3N3OS and a molecular weight of 463.57 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[3-[dimethylidene-[4-(trifluoromethyl)anilino]-λ6-sulfanyl]phenyl]methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[3-[dimethylidene-[4-(trifluoromethyl)anilino]-λ6-sulfanyl]phenyl]methanone |
|---|---|
| PubChem CID | 142385644 |
| Molecular Formula | C24H28F3N3OS |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[3-[dimethylidene-[4-(trifluoromethyl)anilino]-λ6-sulfanyl]phenyl]methanone |
| SMILES | C=S(=C)(Nc1ccc(C(F)(F)F)cc1)c1cccc(C(=O)N2CCN3CCCCC3C2)c1 |
| InChI | InChI=1S/C24H28F3N3OS/c1-32(2,28-20-11-9-19(10-12-20)24(25,26)27)22-8-5-6-18(16-22)23(31)30-15-14-29-13-4-3-7-21(29)17-30/h5-6,8-12,16,21,28H,1-4,7,13-15,17H2 |
| InChIKey | HTPHFMNAAWMWOV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|