C28H41NO6S — CID 142401762
2-ethylhexyl 3-[4-methoxy-3-[2-methoxy-4-(2-methoxyiminopropyl)-5-oxocyclopenten-1-yl]phenyl]sulfanylpropanoate (PubChem CID 142401762) has the molecular formula C28H41NO6S and a molecular weight of 519.70 g/mol. Its IUPAC name is 2-ethylhexyl 3-[4-methoxy-3-[2-methoxy-4-(2-methoxyiminopropyl)-5-oxocyclopenten-1-yl]phenyl]sulfanylpropanoate.
| Compound Name | 2-ethylhexyl 3-[4-methoxy-3-[2-methoxy-4-(2-methoxyiminopropyl)-5-oxocyclopenten-1-yl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 142401762 |
| Molecular Formula | C28H41NO6S |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 2-ethylhexyl 3-[4-methoxy-3-[2-methoxy-4-(2-methoxyiminopropyl)-5-oxocyclopenten-1-yl]phenyl]sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1ccc(OC)c(C2=C(OC)CC(CC(C)=NOC)C2=O)c1 |
| InChI | InChI=1S/C28H41NO6S/c1-7-9-10-20(8-2)18-35-26(30)13-14-36-22-11-12-24(32-4)23(17-22)27-25(33-5)16-21(28(27)31)15-19(3)29-34-6/h11-12,17,20-21H,7-10,13-16,18H2,1-6H3 |
| InChIKey | VYURZAKBEWZQHL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|