C24H37NO4S — CID 86613823
2-ethylhexyl 3-[3-[4-(methoxyiminomethyl)oxan-4-yl]phenyl]sulfanylpropanoate (PubChem CID 86613823) has the molecular formula C24H37NO4S and a molecular weight of 435.63 g/mol. Its IUPAC name is 2-ethylhexyl 3-[3-[4-(methoxyiminomethyl)oxan-4-yl]phenyl]sulfanylpropanoate.
| Compound Name | 2-ethylhexyl 3-[3-[4-(methoxyiminomethyl)oxan-4-yl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 86613823 |
| Molecular Formula | C24H37NO4S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 2-ethylhexyl 3-[3-[4-(methoxyiminomethyl)oxan-4-yl]phenyl]sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1cccc(C2(C=NOC)CCOCC2)c1 |
| InChI | InChI=1S/C24H37NO4S/c1-4-6-8-20(5-2)18-29-23(26)11-16-30-22-10-7-9-21(17-22)24(19-25-27-3)12-14-28-15-13-24/h7,9-10,17,19-20H,4-6,8,11-16,18H2,1-3H3 |
| InChIKey | GNDKWNORJVLLGZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|