C28H42Cl2N4O4 — CID 142630820
2-amino-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]phenyl]-3-methoxy-N-methylbenzamide;dihydrochloride (PubChem CID 142630820) has the molecular formula C28H42Cl2N4O4 and a molecular weight of 569.57 g/mol. Its IUPAC name is 2-amino-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]phenyl]-3-methoxy-N-methylbenzamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]phenyl]-3-methoxy-N-methylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 142630820 |
| Molecular Formula | C28H42Cl2N4O4 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 2-amino-N-[2-[6-[4-(dimethylamino)piperidin-1-yl]-6-oxohexoxy]phenyl]-3-methoxy-N-methylbenzamide;dihydrochloride |
| SMILES | COc1cccc(C(=O)N(C)c2ccccc2OCCCCCC(=O)N2CCC(N(C)C)CC2)c1N.Cl.Cl |
| InChI | InChI=1S/C28H40N4O4.2ClH/c1-30(2)21-16-18-32(19-17-21)26(33)15-6-5-9-20-36-24-13-8-7-12-23(24)31(3)28(34)22-11-10-14-25(35-4)27(22)29;;/h7-8,10-14,21H,5-6,9,15-20,29H2,1-4H3;2*1H |
| InChIKey | IKRVYWWTOBFYAW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|