C11H8N2S — CID 142631117
2-(2H-isoindol-1-yl)-1,3-thiazole (PubChem CID 142631117) has the molecular formula C11H8N2S and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-(2H-isoindol-1-yl)-1,3-thiazole.
| Compound Name | 2-(2H-isoindol-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 142631117 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-(2H-isoindol-1-yl)-1,3-thiazole |
| SMILES | c1ccc2c(-c3nccs3)[nH]cc2c1 |
| InChI | InChI=1S/C11H8N2S/c1-2-4-9-8(3-1)7-13-10(9)11-12-5-6-14-11/h1-7,13H |
| InChIKey | NRKOJPLITWKNIZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |