C11H7N3OS — CID 142637910
4-sulfanylidene-3,5-dihydropyrazolo[5,4-c][1]benzazepin-10-one (PubChem CID 142637910) has the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-sulfanylidene-3,5-dihydropyrazolo[5,4-c][1]benzazepin-10-one.
| Compound Name | 4-sulfanylidene-3,5-dihydropyrazolo[5,4-c][1]benzazepin-10-one |
|---|---|
| PubChem CID | 142637910 |
| Molecular Formula | C11H7N3OS |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 4-sulfanylidene-3,5-dihydropyrazolo[5,4-c][1]benzazepin-10-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)c2[nH]ncc12 |
| InChI | InChI=1S/C11H7N3OS/c15-10-6-3-1-2-4-8(6)13-11(16)9-7(10)5-12-14-9/h1-5H,(H,12,14)(H,13,16) |
| InChIKey | UHEHCKJZXWMAJM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|