C18H22FN3O3S — CID 142659810
2-[[2-[(E)-2-(4-fluorophenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 142659810) has the molecular formula C18H22FN3O3S and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[[2-[(E)-2-(4-fluorophenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 2-[[2-[(E)-2-(4-fluorophenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 142659810 |
| Molecular Formula | C18H22FN3O3S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-[[2-[(E)-2-(4-fluorophenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CCC(O)(Cn1cncn1)SC1COC(/C=C/c2ccc(F)cc2)OC1 |
| InChI | InChI=1S/C18H22FN3O3S/c1-2-18(23,11-22-13-20-12-21-22)26-16-9-24-17(25-10-16)8-5-14-3-6-15(19)7-4-14/h3-8,12-13,16-17,23H,2,9-11H2,1H3/b8-5+ |
| InChIKey | MPOLWHMCQUIMIY-VMPITWQZSA-N |
| XLogP | 2.70 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|