C7H14Cl2O6 — CID 142666939
(2S,3S,4R,5S)-1,1-dichloroheptane-1,2,3,4,5,6-hexol (PubChem CID 142666939) has the molecular formula C7H14Cl2O6 and a molecular weight of 265.09 g/mol. Its IUPAC name is (2S,3S,4R,5S)-1,1-dichloroheptane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,4R,5S)-1,1-dichloroheptane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 142666939 |
| Molecular Formula | C7H14Cl2O6 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | (2S,3S,4R,5S)-1,1-dichloroheptane-1,2,3,4,5,6-hexol |
| SMILES | CC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)(Cl)Cl |
| InChI | InChI=1S/C7H14Cl2O6/c1-2(10)3(11)4(12)5(13)6(14)7(8,9)15/h2-6,10-15H,1H3/t2?,3-,4+,5-,6-/m0/s1 |
| InChIKey | BGAXDZIHNUFVCW-WQBDSHSPSA-N |
| XLogP | -2.07 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|