C16H30O2Si — CID 142714688
(1S,2S,3aR,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol (PubChem CID 142714688) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is (1S,2S,3aR,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol.
| Compound Name | (1S,2S,3aR,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 142714688 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (1S,2S,3aR,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H]2CC=CC[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C16H30O2Si/c1-16(2,3)19(4,5)18-11-14-13-9-7-6-8-12(13)10-15(14)17/h6-7,12-15,17H,8-11H2,1-5H3/t12-,13-,14-,15+/m1/s1 |
| InChIKey | JQVIVELZGBZUSS-TUVASFSCSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|