C6H7ClO7 — CID 142764315
3-chloro-3,4,5,6-tetrahydroxyoxepane-2,7-dione (PubChem CID 142764315) has the molecular formula C6H7ClO7 and a molecular weight of 226.57 g/mol. Its IUPAC name is 3-chloro-3,4,5,6-tetrahydroxyoxepane-2,7-dione.
| Compound Name | 3-chloro-3,4,5,6-tetrahydroxyoxepane-2,7-dione |
|---|---|
| PubChem CID | 142764315 |
| Molecular Formula | C6H7ClO7 |
| Molecular Weight | 226.57 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 3-chloro-3,4,5,6-tetrahydroxyoxepane-2,7-dione |
| SMILES | O=C1OC(=O)C(O)(Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C6H7ClO7/c7-6(13)3(10)1(8)2(9)4(11)14-5(6)12/h1-3,8-10,13H |
| InChIKey | RVRNCKGKQAVAMH-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.57 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|