C9H15N3 — CID 142875406
ethane;2-methyl-4,5-dihydrobenzotriazole (PubChem CID 142875406) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;2-methyl-4,5-dihydrobenzotriazole.
| Compound Name | ethane;2-methyl-4,5-dihydrobenzotriazole |
|---|---|
| PubChem CID | 142875406 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethane;2-methyl-4,5-dihydrobenzotriazole |
| SMILES | CC.Cn1nc2c(n1)CCC=C2 |
| InChI | InChI=1S/C7H9N3.C2H6/c1-10-8-6-4-2-3-5-7(6)9-10;1-2/h2,4H,3,5H2,1H3;1-2H3 |
| InChIKey | DGAVVDWJIKCMNM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |