C12H18NP — CID 143240842
5,6-dihydroquinolin-2-yl(methyl)phosphane;ethane (PubChem CID 143240842) has the molecular formula C12H18NP and a molecular weight of 207.26 g/mol. Its IUPAC name is 5,6-dihydroquinolin-2-yl(methyl)phosphane;ethane.
| Compound Name | 5,6-dihydroquinolin-2-yl(methyl)phosphane;ethane |
|---|---|
| PubChem CID | 143240842 |
| Molecular Formula | C12H18NP |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 5,6-dihydroquinolin-2-yl(methyl)phosphane;ethane |
| SMILES | CC.CPc1ccc2c(n1)C=CCC2 |
| InChI | InChI=1S/C10H12NP.C2H6/c1-12-10-7-6-8-4-2-3-5-9(8)11-10;1-2/h3,5-7,12H,2,4H2,1H3;1-2H3 |
| InChIKey | CQHDTKBKEGWEJT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|