C29H45FO4 — CID 142882362
trans-(1R,3R)-5-[(2E)-2-[1-[(2E,4E)-6-ethyl-6-hydroxyocta-2,4-dienyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(fluoromethyl)cyclohexane-1,2,3-triol (PubChem CID 142882362) has the molecular formula C29H45FO4 and a molecular weight of 476.67 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[1-[(2E,4E)-6-ethyl-6-hydroxyocta-2,4-dienyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(fluoromethyl)cyclohexane-1,2,3-triol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[1-[(2E,4E)-6-ethyl-6-hydroxyocta-2,4-dienyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(fluoromethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 142882362 |
| Molecular Formula | C29H45FO4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[1-[(2E,4E)-6-ethyl-6-hydroxyocta-2,4-dienyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(fluoromethyl)cyclohexane-1,2,3-triol |
| SMILES | CCC(O)(/C=C/C=C/CC1CCC2/C(=C/C=C3C[C@@H](O)C(O)(CF)[C@H](O)C3)CCCC12C)CC |
| InChI | InChI=1S/C29H45FO4/c1-4-28(33,5-2)17-8-6-7-11-23-14-15-24-22(10-9-16-27(23,24)3)13-12-21-18-25(31)29(34,20-30)26(32)19-21/h6-8,12-13,17,23-26,31-34H,4-5,9-11,14-16,18-20H2,1-3H3/b7-6+,17-8+,21-12-,22-13+/t23?,24?,25-,26-,27?,29?/m1/s1 |
| InChIKey | AWLZXKSEIFQNRY-RKDKSVTESA-N |
| XLogP | 5.33 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|