C12H17ClN4O — CID 142915819
(2E,4Z)-N'-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienyl]-2-ethenylhexa-2,4-dienehydrazide (PubChem CID 142915819) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is (2E,4Z)-N'-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienyl]-2-ethenylhexa-2,4-dienehydrazide.
| Compound Name | (2E,4Z)-N'-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienyl]-2-ethenylhexa-2,4-dienehydrazide |
|---|---|
| PubChem CID | 142915819 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2E,4Z)-N'-[(1E,3E)-1,4-diamino-4-chlorobuta-1,3-dienyl]-2-ethenylhexa-2,4-dienehydrazide |
| SMILES | C=C/C(=C\C=C/C)C(=O)NN/C(N)=C/C=C(\N)Cl |
| InChI | InChI=1S/C12H17ClN4O/c1-3-5-6-9(4-2)12(18)17-16-11(15)8-7-10(13)14/h3-8,16H,2,14-15H2,1H3,(H,17,18)/b5-3-,9-6+,10-7-,11-8+ |
| InChIKey | ASTIORKLPOLEMH-JENMAGSJSA-N |
| XLogP | 1.13 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|