C12H15NS — CID 142918181
(1E,4Z)-N-methyl-1-(2H-thiopyran-6-yl)hexa-1,4-dien-3-imine (PubChem CID 142918181) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is (1E,4Z)-N-methyl-1-(2H-thiopyran-6-yl)hexa-1,4-dien-3-imine.
| Compound Name | (1E,4Z)-N-methyl-1-(2H-thiopyran-6-yl)hexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 142918181 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (1E,4Z)-N-methyl-1-(2H-thiopyran-6-yl)hexa-1,4-dien-3-imine |
| SMILES | C/C=C\C(\C=C\C1=CC=CCS1)=N/C |
| InChI | InChI=1S/C12H15NS/c1-3-6-11(13-2)8-9-12-7-4-5-10-14-12/h3-9H,10H2,1-2H3/b6-3-,9-8+,13-11+ |
| InChIKey | OTCLNPIVWOKCMN-OAWBQKOQSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|