C16H21NO — CID 142935728
(4Z)-2-methylhexa-2,4-diene;3-methylidene-5,6-dihydro-1H-indol-2-one (PubChem CID 142935728) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (4Z)-2-methylhexa-2,4-diene;3-methylidene-5,6-dihydro-1H-indol-2-one.
| Compound Name | (4Z)-2-methylhexa-2,4-diene;3-methylidene-5,6-dihydro-1H-indol-2-one |
|---|---|
| PubChem CID | 142935728 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (4Z)-2-methylhexa-2,4-diene;3-methylidene-5,6-dihydro-1H-indol-2-one |
| SMILES | C/C=C\C=C(C)C.C=C1C(=O)NC2=CCCC=C12 |
| InChI | InChI=1S/C9H9NO.C7H12/c1-6-7-4-2-3-5-8(7)10-9(6)11;1-4-5-6-7(2)3/h4-5H,1-3H2,(H,10,11);4-6H,1-3H3/b;5-4- |
| InChIKey | NZOURAGDPOTKCH-GUHKXDMSSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|