C19H38N2O3 — CID 142936631
1-[4-(3-ethoxybut-3-enylamino)-2,2,6,6-tetramethylpiperidin-1-yl]oxy-2-methylpropan-2-ol (PubChem CID 142936631) has the molecular formula C19H38N2O3 and a molecular weight of 342.52 g/mol. Its IUPAC name is 1-[4-(3-ethoxybut-3-enylamino)-2,2,6,6-tetramethylpiperidin-1-yl]oxy-2-methylpropan-2-ol.
| Compound Name | 1-[4-(3-ethoxybut-3-enylamino)-2,2,6,6-tetramethylpiperidin-1-yl]oxy-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 142936631 |
| Molecular Formula | C19H38N2O3 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | 1-[4-(3-ethoxybut-3-enylamino)-2,2,6,6-tetramethylpiperidin-1-yl]oxy-2-methylpropan-2-ol |
| SMILES | C=C(CCNC1CC(C)(C)N(OCC(C)(C)O)C(C)(C)C1)OCC |
| InChI | InChI=1S/C19H38N2O3/c1-9-23-15(2)10-11-20-16-12-17(3,4)21(18(5,6)13-16)24-14-19(7,8)22/h16,20,22H,2,9-14H2,1,3-8H3 |
| InChIKey | SXRVEIUICSBYIE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|