C14H24N2 — CID 142941810
(3E,5E)-5-ethylidene-3-propylidene-2,9-diazaspiro[5.5]undecane (PubChem CID 142941810) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (3E,5E)-5-ethylidene-3-propylidene-2,9-diazaspiro[5.5]undecane.
| Compound Name | (3E,5E)-5-ethylidene-3-propylidene-2,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 142941810 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (3E,5E)-5-ethylidene-3-propylidene-2,9-diazaspiro[5.5]undecane |
| SMILES | C/C=C1\C/C(=C\CC)NCC12CCNCC2 |
| InChI | InChI=1S/C14H24N2/c1-3-5-13-10-12(4-2)14(11-16-13)6-8-15-9-7-14/h4-5,15-16H,3,6-11H2,1-2H3/b12-4+,13-5+ |
| InChIKey | WYAUOQSVDGUYLB-QGVJZHQLSA-N |
| XLogP | 2.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|