C26H18N6O4 — CID 14296593
(4-nitrophenyl)-[2-(4-nitrophenyl)-4,5-diphenyltriazol-1-ium-1-yl]azanide (PubChem CID 14296593) has the molecular formula C26H18N6O4 and a molecular weight of 478.47 g/mol. Its IUPAC name is (4-nitrophenyl)-[2-(4-nitrophenyl)-4,5-diphenyltriazol-1-ium-1-yl]azanide.
| Compound Name | (4-nitrophenyl)-[2-(4-nitrophenyl)-4,5-diphenyltriazol-1-ium-1-yl]azanide |
|---|---|
| PubChem CID | 14296593 |
| Molecular Formula | C26H18N6O4 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (4-nitrophenyl)-[2-(4-nitrophenyl)-4,5-diphenyltriazol-1-ium-1-yl]azanide |
| SMILES | O=[N+]([O-])c1ccc([N-][n+]2c(-c3ccccc3)c(-c3ccccc3)nn2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H18N6O4/c33-31(34)23-13-11-21(12-14-23)27-30-26(20-9-5-2-6-10-20)25(19-7-3-1-4-8-19)28-29(30)22-15-17-24(18-16-22)32(35)36/h1-18H |
| InChIKey | ZGEBYAOELXBECH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 122.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|