C15H12N6O2S — CID 10315192
8-methyl-2-(4-nitrophenyl)-7-phenyl-1lambda4-thia-2,3,4,6,8-pentazabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 10315192) has the molecular formula C15H12N6O2S and a molecular weight of 340.37 g/mol. Its IUPAC name is 8-methyl-2-(4-nitrophenyl)-7-phenyl-1lambda4-thia-2,3,4,6,8-pentazabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 8-methyl-2-(4-nitrophenyl)-7-phenyl-1lambda4-thia-2,3,4,6,8-pentazabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 10315192 |
| Molecular Formula | C15H12N6O2S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 8-methyl-2-(4-nitrophenyl)-7-phenyl-1lambda4-thia-2,3,4,6,8-pentazabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | CN1C(c2ccccc2)=NC2=S1N(c1ccc([N+](=O)[O-])cc1)N=N2 |
| InChI | InChI=1S/C15H12N6O2S/c1-19-14(11-5-3-2-4-6-11)16-15-17-18-20(24(15)19)12-7-9-13(10-8-12)21(22)23/h2-10H,1H3 |
| InChIKey | KYMCDUJVWUXMFU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|