C12H22ClNO4 — CID 143060486
(2-chloro-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) 3-hydroxy-2-methylpropanoate (PubChem CID 143060486) has the molecular formula C12H22ClNO4 and a molecular weight of 279.76 g/mol. Its IUPAC name is (2-chloro-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) 3-hydroxy-2-methylpropanoate.
| Compound Name | (2-chloro-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) 3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 143060486 |
| Molecular Formula | C12H22ClNO4 |
| Molecular Weight | 279.76 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (2-chloro-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) 3-hydroxy-2-methylpropanoate |
| SMILES | CC(CO)C(=O)OC1CC(C)(C)N(O)C(C)(Cl)C1 |
| InChI | InChI=1S/C12H22ClNO4/c1-8(7-15)10(16)18-9-5-11(2,3)14(17)12(4,13)6-9/h8-9,15,17H,5-7H2,1-4H3 |
| InChIKey | CXBPXJNTBYXVAY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.76 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|