C10H12ClN3 — CID 143061488
2-(4-chloro-5-methyl-4,5-dihydro-1H-pyrazol-3-yl)-6-methylpyridine (PubChem CID 143061488) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-(4-chloro-5-methyl-4,5-dihydro-1H-pyrazol-3-yl)-6-methylpyridine.
| Compound Name | 2-(4-chloro-5-methyl-4,5-dihydro-1H-pyrazol-3-yl)-6-methylpyridine |
|---|---|
| PubChem CID | 143061488 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(4-chloro-5-methyl-4,5-dihydro-1H-pyrazol-3-yl)-6-methylpyridine |
| SMILES | Cc1cccc(C2=NNC(C)C2Cl)n1 |
| InChI | InChI=1S/C10H12ClN3/c1-6-4-3-5-8(12-6)10-9(11)7(2)13-14-10/h3-5,7,9,13H,1-2H3 |
| InChIKey | CVRHKXLSYMELOX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|