C19H30N4O2S2 — CID 143074797
1,1-dicyclohexyl-3-[5-(2-methyl-1-oxopropan-2-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea (PubChem CID 143074797) has the molecular formula C19H30N4O2S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-[5-(2-methyl-1-oxopropan-2-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1,1-dicyclohexyl-3-[5-(2-methyl-1-oxopropan-2-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 143074797 |
| Molecular Formula | C19H30N4O2S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1,1-dicyclohexyl-3-[5-(2-methyl-1-oxopropan-2-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea |
| SMILES | CC(C)(C=O)Sc1nnc(NC(=O)N(C2CCCCC2)C2CCCCC2)s1 |
| InChI | InChI=1S/C19H30N4O2S2/c1-19(2,13-24)27-18-22-21-16(26-18)20-17(25)23(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h13-15H,3-12H2,1-2H3,(H,20,21,25) |
| InChIKey | DTFMPFDLMLKOKV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|