C19H33N5O2S2 — CID 143076515
2-N'-(5-aminosulfanyl-4-hydroxythiophen-3-yl)-1-N'-[(4-propan-2-ylfuran-2-yl)methyl]ethanediimidamide;ethane;propane (PubChem CID 143076515) has the molecular formula C19H33N5O2S2 and a molecular weight of 427.64 g/mol. Its IUPAC name is 2-N'-(5-aminosulfanyl-4-hydroxythiophen-3-yl)-1-N'-[(4-propan-2-ylfuran-2-yl)methyl]ethanediimidamide;ethane;propane.
| Compound Name | 2-N'-(5-aminosulfanyl-4-hydroxythiophen-3-yl)-1-N'-[(4-propan-2-ylfuran-2-yl)methyl]ethanediimidamide;ethane;propane |
|---|---|
| PubChem CID | 143076515 |
| Molecular Formula | C19H33N5O2S2 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-N'-(5-aminosulfanyl-4-hydroxythiophen-3-yl)-1-N'-[(4-propan-2-ylfuran-2-yl)methyl]ethanediimidamide;ethane;propane |
| SMILES | CC.CC(C)c1coc(C/N=C(N)/C(N)=N/c2csc(SN)c2O)c1.CCC |
| InChI | InChI=1S/C14H19N5O2S2.C3H8.C2H6/c1-7(2)8-3-9(21-5-8)4-18-12(15)13(16)19-10-6-22-14(23-17)11(10)20;1-3-2;1-2/h3,5-7,20H,4,17H2,1-2H3,(H2,15,18)(H2,16,19);3H2,1-2H3;1-2H3 |
| InChIKey | FFYSQJDUBCYNDB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|