C23H25FO2S — CID 143099697
2-[3-[(4-ethylphenyl)methyl]-1-benzothiophen-5-yl]-6-(fluoromethyl)oxan-4-ol (PubChem CID 143099697) has the molecular formula C23H25FO2S and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[3-[(4-ethylphenyl)methyl]-1-benzothiophen-5-yl]-6-(fluoromethyl)oxan-4-ol.
| Compound Name | 2-[3-[(4-ethylphenyl)methyl]-1-benzothiophen-5-yl]-6-(fluoromethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143099697 |
| Molecular Formula | C23H25FO2S |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[3-[(4-ethylphenyl)methyl]-1-benzothiophen-5-yl]-6-(fluoromethyl)oxan-4-ol |
| SMILES | CCc1ccc(Cc2csc3ccc(C4CC(O)CC(CF)O4)cc23)cc1 |
| InChI | InChI=1S/C23H25FO2S/c1-2-15-3-5-16(6-4-15)9-18-14-27-23-8-7-17(10-21(18)23)22-12-19(25)11-20(13-24)26-22/h3-8,10,14,19-20,22,25H,2,9,11-13H2,1H3 |
| InChIKey | HVJOMEUSPABUGN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |