C18H17N3O6S — CID 143109392
N-[4-(4,6-dimethoxypyrimidin-2-yl)phenyl]-3,4-dihydroxybenzenesulfonamide (PubChem CID 143109392) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is N-[4-(4,6-dimethoxypyrimidin-2-yl)phenyl]-3,4-dihydroxybenzenesulfonamide.
| Compound Name | N-[4-(4,6-dimethoxypyrimidin-2-yl)phenyl]-3,4-dihydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 143109392 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[4-(4,6-dimethoxypyrimidin-2-yl)phenyl]-3,4-dihydroxybenzenesulfonamide |
| SMILES | COc1cc(OC)nc(-c2ccc(NS(=O)(=O)c3ccc(O)c(O)c3)cc2)n1 |
| InChI | InChI=1S/C18H17N3O6S/c1-26-16-10-17(27-2)20-18(19-16)11-3-5-12(6-4-11)21-28(24,25)13-7-8-14(22)15(23)9-13/h3-10,21-23H,1-2H3 |
| InChIKey | GHASORWNYUZPMW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|