C12H27N3 — CID 143115343
(2Z)-N,3-dimethylpenta-2,4-dien-1-imine;ethanamine;N-methylethanamine (PubChem CID 143115343) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;ethanamine;N-methylethanamine.
| Compound Name | (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;ethanamine;N-methylethanamine |
|---|---|
| PubChem CID | 143115343 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;ethanamine;N-methylethanamine |
| SMILES | C=C/C(C)=C\C=N\C.CCN.CCNC |
| InChI | InChI=1S/C7H11N.C3H9N.C2H7N/c1-4-7(2)5-6-8-3;1-3-4-2;1-2-3/h4-6H,1H2,2-3H3;4H,3H2,1-2H3;2-3H2,1H3/b7-5-,8-6+;; |
| InChIKey | OPLULJQANDBLDL-RRBJLESWSA-N |
| XLogP | 2.01 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|