C22H21N3O2S — CID 143160092
13-but-2-ynoxy-5-[(2E,4Z,6Z)-5-methylocta-2,4,6-trien-2-yl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 143160092) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 13-but-2-ynoxy-5-[(2E,4Z,6Z)-5-methylocta-2,4,6-trien-2-yl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-but-2-ynoxy-5-[(2E,4Z,6Z)-5-methylocta-2,4,6-trien-2-yl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 143160092 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 13-but-2-ynoxy-5-[(2E,4Z,6Z)-5-methylocta-2,4,6-trien-2-yl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | CC#CCOc1ccnc2sc3c(=O)n(/C(C)=C/C=C(C)\C=C/C)cnc3c12 |
| InChI | InChI=1S/C22H21N3O2S/c1-5-7-13-27-17-11-12-23-21-18(17)19-20(28-21)22(26)25(14-24-19)16(4)10-9-15(3)8-6-2/h6,8-12,14H,13H2,1-4H3/b8-6-,15-9-,16-10+ |
| InChIKey | VWNPHHFFMYCFDD-VYNTZLQDSA-N |
| XLogP | 4.79 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|