C7H11BrNO+ — CID 143187904
5-bromo-1-methoxy-2-methyl-1,2-dihydropyridin-1-ium (PubChem CID 143187904) has the molecular formula C7H11BrNO+ and a molecular weight of 205.07 g/mol. Its IUPAC name is 5-bromo-1-methoxy-2-methyl-1,2-dihydropyridin-1-ium.
| Compound Name | 5-bromo-1-methoxy-2-methyl-1,2-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 143187904 |
| Molecular Formula | C7H11BrNO+ |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | 5-bromo-1-methoxy-2-methyl-1,2-dihydropyridin-1-ium |
| SMILES | CO[NH+]1C=C(Br)C=CC1C |
| InChI | InChI=1S/C7H10BrNO/c1-6-3-4-7(8)5-9(6)10-2/h3-6H,1-2H3/p+1 |
| InChIKey | DSZQLSHWEWSFNC-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |