C20H19ClN2O3 — CID 143190230
2-[1-[[2-amino-5-(4-hydroxyphenyl)-3-pyridinyl]oxy]ethyl]-3-chloro-6-methylphenol (PubChem CID 143190230) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[1-[[2-amino-5-(4-hydroxyphenyl)-3-pyridinyl]oxy]ethyl]-3-chloro-6-methylphenol.
| Compound Name | 2-[1-[[2-amino-5-(4-hydroxyphenyl)-3-pyridinyl]oxy]ethyl]-3-chloro-6-methylphenol |
|---|---|
| PubChem CID | 143190230 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[1-[[2-amino-5-(4-hydroxyphenyl)-3-pyridinyl]oxy]ethyl]-3-chloro-6-methylphenol |
| SMILES | Cc1ccc(Cl)c(C(C)Oc2cc(-c3ccc(O)cc3)cnc2N)c1O |
| InChI | InChI=1S/C20H19ClN2O3/c1-11-3-8-16(21)18(19(11)25)12(2)26-17-9-14(10-23-20(17)22)13-4-6-15(24)7-5-13/h3-10,12,24-25H,1-2H3,(H2,22,23) |
| InChIKey | NKHGYBLQMWAQND-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |