C23H28ClN4O3P — CID 143190245
4-[6-amino-5-[1-(6-chloro-2-hydroxy-3-phosphanylphenyl)ethoxy]-3-pyridinyl]benzamide;N-methylethanamine (PubChem CID 143190245) has the molecular formula C23H28ClN4O3P and a molecular weight of 474.93 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(6-chloro-2-hydroxy-3-phosphanylphenyl)ethoxy]-3-pyridinyl]benzamide;N-methylethanamine.
| Compound Name | 4-[6-amino-5-[1-(6-chloro-2-hydroxy-3-phosphanylphenyl)ethoxy]-3-pyridinyl]benzamide;N-methylethanamine |
|---|---|
| PubChem CID | 143190245 |
| Molecular Formula | C23H28ClN4O3P |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4-[6-amino-5-[1-(6-chloro-2-hydroxy-3-phosphanylphenyl)ethoxy]-3-pyridinyl]benzamide;N-methylethanamine |
| SMILES | CC(Oc1cc(-c2ccc(C(N)=O)cc2)cnc1N)c1c(Cl)ccc(P)c1O.CCNC |
| InChI | InChI=1S/C20H19ClN3O3P.C3H9N/c1-10(17-14(21)6-7-16(28)18(17)25)27-15-8-13(9-24-19(15)22)11-2-4-12(5-3-11)20(23)26;1-3-4-2/h2-10,25H,28H2,1H3,(H2,22,24)(H2,23,26);4H,3H2,1-2H3 |
| InChIKey | BCUDHLRJDMFMQT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|