C27H46O2 — CID 143203313
heptane;6-heptan-4-yl-7,7-dimethyl-3,8-dihydro-2H-cyclopenta[g][1]benzofuran-6-ol (PubChem CID 143203313) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is heptane;6-heptan-4-yl-7,7-dimethyl-3,8-dihydro-2H-cyclopenta[g][1]benzofuran-6-ol.
| Compound Name | heptane;6-heptan-4-yl-7,7-dimethyl-3,8-dihydro-2H-cyclopenta[g][1]benzofuran-6-ol |
|---|---|
| PubChem CID | 143203313 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | heptane;6-heptan-4-yl-7,7-dimethyl-3,8-dihydro-2H-cyclopenta[g][1]benzofuran-6-ol |
| SMILES | CCCC(CCC)C1(O)c2ccc3c(c2CC1(C)C)OCC3.CCCCCCC |
| InChI | InChI=1S/C20H30O2.C7H16/c1-5-7-15(8-6-2)20(21)17-10-9-14-11-12-22-18(14)16(17)13-19(20,3)4;1-3-5-7-6-4-2/h9-10,15,21H,5-8,11-13H2,1-4H3;3-7H2,1-2H3 |
| InChIKey | KPBHYBQOROLCMX-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|