C35H46 — CID 143205790
ethene;1-ethenyl-4-pentylbenzene;1-methyl-2-[(E)-1-(4-methylphenyl)hex-1-en-2-yl]benzene (PubChem CID 143205790) has the molecular formula C35H46 and a molecular weight of 466.75 g/mol. Its IUPAC name is ethene;1-ethenyl-4-pentylbenzene;1-methyl-2-[(E)-1-(4-methylphenyl)hex-1-en-2-yl]benzene.
| Compound Name | ethene;1-ethenyl-4-pentylbenzene;1-methyl-2-[(E)-1-(4-methylphenyl)hex-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 143205790 |
| Molecular Formula | C35H46 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.36 |
| IUPAC Name | ethene;1-ethenyl-4-pentylbenzene;1-methyl-2-[(E)-1-(4-methylphenyl)hex-1-en-2-yl]benzene |
| SMILES | C=C.C=Cc1ccc(CCCCC)cc1.CCCC/C(=C\c1ccc(C)cc1)c1ccccc1C |
| InChI | InChI=1S/C20H24.C13H18.C2H4/c1-4-5-9-19(20-10-7-6-8-17(20)3)15-18-13-11-16(2)12-14-18;1-3-5-6-7-13-10-8-12(4-2)9-11-13;1-2/h6-8,10-15H,4-5,9H2,1-3H3;4,8-11H,2-3,5-7H2,1H3;1-2H2/b19-15+;; |
| InChIKey | SXOGVVPDTYLNQN-WTBAQZMLSA-N |
| XLogP | 10.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|