C15H21FN2S — CID 143208219
[[(Z)-3-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-2-(methylamino)prop-1-enyl]amino]methanethiol (PubChem CID 143208219) has the molecular formula C15H21FN2S and a molecular weight of 280.41 g/mol. Its IUPAC name is [[(Z)-3-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-2-(methylamino)prop-1-enyl]amino]methanethiol.
| Compound Name | [[(Z)-3-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-2-(methylamino)prop-1-enyl]amino]methanethiol |
|---|---|
| PubChem CID | 143208219 |
| Molecular Formula | C15H21FN2S |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [[(Z)-3-(5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-2-(methylamino)prop-1-enyl]amino]methanethiol |
| SMILES | CN/C(=C\NCS)CC1CCCc2c(F)cccc21 |
| InChI | InChI=1S/C15H21FN2S/c1-17-12(9-18-10-19)8-11-4-2-6-14-13(11)5-3-7-15(14)16/h3,5,7,9,11,17-19H,2,4,6,8,10H2,1H3/b12-9- |
| InChIKey | XVRIXEFJQODSTI-XFXZXTDPSA-N |
| XLogP | 3.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|