C11H17NO2 — CID 143218986
2-(4,5-dimethoxycyclohepta-1,4,6-trien-1-yl)ethanamine (PubChem CID 143218986) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(4,5-dimethoxycyclohepta-1,4,6-trien-1-yl)ethanamine.
| Compound Name | 2-(4,5-dimethoxycyclohepta-1,4,6-trien-1-yl)ethanamine |
|---|---|
| PubChem CID | 143218986 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(4,5-dimethoxycyclohepta-1,4,6-trien-1-yl)ethanamine |
| SMILES | COC1=C(OC)CC=C(CCN)C=C1 |
| InChI | InChI=1S/C11H17NO2/c1-13-10-5-3-9(7-8-12)4-6-11(10)14-2/h3-5H,6-8,12H2,1-2H3 |
| InChIKey | ITRBSMVJWNNFHT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |