C32H31N5 — CID 143250733
3-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1-N,2-N,5-N-trimethylbenzene-1,2,4,5-tetramine (PubChem CID 143250733) has the molecular formula C32H31N5 and a molecular weight of 485.64 g/mol. Its IUPAC name is 3-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1-N,2-N,5-N-trimethylbenzene-1,2,4,5-tetramine.
| Compound Name | 3-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1-N,2-N,5-N-trimethylbenzene-1,2,4,5-tetramine |
|---|---|
| PubChem CID | 143250733 |
| Molecular Formula | C32H31N5 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 3-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1-N,2-N,5-N-trimethylbenzene-1,2,4,5-tetramine |
| SMILES | CNc1cc(NC)c(NC)c(-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)cc2)c1N |
| InChI | InChI=1S/C32H31N5/c1-34-28-20-29(35-2)32(36-3)30(31(28)33)24-16-14-21(15-17-24)25-18-26(22-10-6-4-7-11-22)37-27(19-25)23-12-8-5-9-13-23/h4-20,34-36H,33H2,1-3H3 |
| InChIKey | MJLLDKZUQKXNQT-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|