C18H19N — CID 143277147
(2E,3Z,5E)-5-(4-cyclopropylphenyl)-2-ethylidenehepta-3,5-dienenitrile (PubChem CID 143277147) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is (2E,3Z,5E)-5-(4-cyclopropylphenyl)-2-ethylidenehepta-3,5-dienenitrile.
| Compound Name | (2E,3Z,5E)-5-(4-cyclopropylphenyl)-2-ethylidenehepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 143277147 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2E,3Z,5E)-5-(4-cyclopropylphenyl)-2-ethylidenehepta-3,5-dienenitrile |
| SMILES | C/C=C(C#N)\C=C/C(=C\C)c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C18H19N/c1-3-14(13-19)5-6-15(4-2)16-7-9-17(10-8-16)18-11-12-18/h3-10,18H,11-12H2,1-2H3/b6-5-,14-3+,15-4+ |
| InChIKey | DVRKDVYWEKFXOC-GJAJGLSSSA-N |
| XLogP | 4.99 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|