C34H57N3 — CID 143344580
(Z,2S,3E)-N-[(5E)-3-but-1-en-2-ylimino-6,8-dimethylnona-1,5,8-trien-2-yl]-3-ethylidene-6,7-dimethylidenenon-4-en-2-amine;ethane;2-methylprop-2-en-1-amine (PubChem CID 143344580) has the molecular formula C34H57N3 and a molecular weight of 507.85 g/mol. Its IUPAC name is (Z,2S,3E)-N-[(5E)-3-but-1-en-2-ylimino-6,8-dimethylnona-1,5,8-trien-2-yl]-3-ethylidene-6,7-dimethylidenenon-4-en-2-amine;ethane;2-methylprop-2-en-1-amine.
| Compound Name | (Z,2S,3E)-N-[(5E)-3-but-1-en-2-ylimino-6,8-dimethylnona-1,5,8-trien-2-yl]-3-ethylidene-6,7-dimethylidenenon-4-en-2-amine;ethane;2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 143344580 |
| Molecular Formula | C34H57N3 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 507.46 |
| IUPAC Name | (Z,2S,3E)-N-[(5E)-3-but-1-en-2-ylimino-6,8-dimethylnona-1,5,8-trien-2-yl]-3-ethylidene-6,7-dimethylidenenon-4-en-2-amine;ethane;2-methylprop-2-en-1-amine |
| SMILES | C=C(C)C/C(C)=C/C/C(=N\C(=C)CC)C(=C)N[C@@H](C)C(/C=C\C(=C)C(=C)CC)=C/C.C=C(C)CN.CC |
| InChI | InChI=1S/C28H42N2.C4H9N.C2H6/c1-12-22(7)23(8)16-17-27(14-3)25(10)30-26(11)28(29-24(9)13-2)18-15-21(6)19-20(4)5;1-4(2)3-5;1-2/h14-17,25,30H,4,7-9,11-13,18-19H2,1-3,5-6,10H3;1,3,5H2,2H3;1-2H3/b17-16-,21-15+,27-14+,29-28+;;/t25-;;/m0../s1 |
| InChIKey | FHHHVLQEAMMJRS-RJQUNUFSSA-N |
| XLogP | 9.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|