C12H17N3 — CID 143345880
(E)-(6-but-1-en-2-yl-4-ethenyl-1-methylpyrimidin-2-ylidene)methanamine (PubChem CID 143345880) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is (E)-(6-but-1-en-2-yl-4-ethenyl-1-methylpyrimidin-2-ylidene)methanamine.
| Compound Name | (E)-(6-but-1-en-2-yl-4-ethenyl-1-methylpyrimidin-2-ylidene)methanamine |
|---|---|
| PubChem CID | 143345880 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (E)-(6-but-1-en-2-yl-4-ethenyl-1-methylpyrimidin-2-ylidene)methanamine |
| SMILES | C=CC1=N/C(=C/N)N(C)C(C(=C)CC)=C1 |
| InChI | InChI=1S/C12H17N3/c1-5-9(3)11-7-10(6-2)14-12(8-13)15(11)4/h6-8H,2-3,5,13H2,1,4H3/b12-8- |
| InChIKey | AFPGSBCYBXZPJD-WQLSENKSSA-N |
| XLogP | 2.17 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |