C15H20N2O2 — CID 143418701
N-[(3E,6Z)-3-ethylidene-5-iminonona-1,6,8-trien-4-yl]-2-oxobutanamide (PubChem CID 143418701) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[(3E,6Z)-3-ethylidene-5-iminonona-1,6,8-trien-4-yl]-2-oxobutanamide.
| Compound Name | N-[(3E,6Z)-3-ethylidene-5-iminonona-1,6,8-trien-4-yl]-2-oxobutanamide |
|---|---|
| PubChem CID | 143418701 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-[(3E,6Z)-3-ethylidene-5-iminonona-1,6,8-trien-4-yl]-2-oxobutanamide |
| SMILES | [H]/N=C(\C=C/C=C)C(NC(=O)C(=O)CC)/C(C=C)=C/C |
| InChI | InChI=1S/C15H20N2O2/c1-5-9-10-12(16)14(11(6-2)7-3)17-15(19)13(18)8-4/h5-7,9-10,14,16H,1-2,8H2,3-4H3,(H,17,19)/b10-9-,11-7+,16-12+ |
| InChIKey | PJRHEPUKCOXZHE-HJCUJUBBSA-N |
| XLogP | 2.34 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|