C24H32F2N2 — CID 143420668
(2Z,5Z)-3-[1-(2,4-difluorophenyl)ethenyl]-7-methyl-4-methylimino-N-(2-methylpentan-2-yl)octa-2,5,7-trien-2-amine (PubChem CID 143420668) has the molecular formula C24H32F2N2 and a molecular weight of 386.53 g/mol. Its IUPAC name is (2Z,5Z)-3-[1-(2,4-difluorophenyl)ethenyl]-7-methyl-4-methylimino-N-(2-methylpentan-2-yl)octa-2,5,7-trien-2-amine.
| Compound Name | (2Z,5Z)-3-[1-(2,4-difluorophenyl)ethenyl]-7-methyl-4-methylimino-N-(2-methylpentan-2-yl)octa-2,5,7-trien-2-amine |
|---|---|
| PubChem CID | 143420668 |
| Molecular Formula | C24H32F2N2 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (2Z,5Z)-3-[1-(2,4-difluorophenyl)ethenyl]-7-methyl-4-methylimino-N-(2-methylpentan-2-yl)octa-2,5,7-trien-2-amine |
| SMILES | C=C(C)/C=C\C(=N\C)\C(C(=C)c1ccc(F)cc1F)=C(\C)NC(C)(C)CCC |
| InChI | InChI=1S/C24H32F2N2/c1-9-14-24(6,7)28-18(5)23(22(27-8)13-10-16(2)3)17(4)20-12-11-19(25)15-21(20)26/h10-13,15,28H,2,4,9,14H2,1,3,5-8H3/b13-10-,23-18-,27-22- |
| InChIKey | SWGZALXKWZAZAP-DXHHJXSDSA-N |
| XLogP | 6.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|