C27H25FO5 — CID 143443943
4-[(E)-3-[(4-carboxyphenyl)methyl]-5-(5-fluoro-2-methoxyphenyl)pent-4-enyl]benzoic acid (PubChem CID 143443943) has the molecular formula C27H25FO5 and a molecular weight of 448.49 g/mol. Its IUPAC name is 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-(5-fluoro-2-methoxyphenyl)pent-4-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-(5-fluoro-2-methoxyphenyl)pent-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 143443943 |
| Molecular Formula | C27H25FO5 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-(5-fluoro-2-methoxyphenyl)pent-4-enyl]benzoic acid |
| SMILES | COc1ccc(F)cc1/C=C/C(CCc1ccc(C(=O)O)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H25FO5/c1-33-25-15-14-24(28)17-23(25)13-8-19(16-20-6-11-22(12-7-20)27(31)32)3-2-18-4-9-21(10-5-18)26(29)30/h4-15,17,19H,2-3,16H2,1H3,(H,29,30)(H,31,32)/b13-8+ |
| InChIKey | JLADVBPXZRLMTN-MDWZMJQESA-N |
| XLogP | 5.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |