C22H22N2O2 — CID 143479373
(2Z)-3-hydroxy-N,N,2-trimethyl-4-[3-(2-phenylethynyl)anilino]penta-2,4-dienamide (PubChem CID 143479373) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2Z)-3-hydroxy-N,N,2-trimethyl-4-[3-(2-phenylethynyl)anilino]penta-2,4-dienamide.
| Compound Name | (2Z)-3-hydroxy-N,N,2-trimethyl-4-[3-(2-phenylethynyl)anilino]penta-2,4-dienamide |
|---|---|
| PubChem CID | 143479373 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2Z)-3-hydroxy-N,N,2-trimethyl-4-[3-(2-phenylethynyl)anilino]penta-2,4-dienamide |
| SMILES | C=C(Nc1cccc(C#Cc2ccccc2)c1)/C(O)=C(\C)C(=O)N(C)C |
| InChI | InChI=1S/C22H22N2O2/c1-16(22(26)24(3)4)21(25)17(2)23-20-12-8-11-19(15-20)14-13-18-9-6-5-7-10-18/h5-12,15,23,25H,2H2,1,3-4H3/b21-16- |
| InChIKey | SARYCLCCWKKYTP-PGMHBOJBSA-N |
| XLogP | 3.93 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|