C19H16F3N5O — CID 143479803
(Z)-3-[5-[(4-hydroxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]-N'-[3-(trifluoromethyl)phenyl]prop-2-enimidamide (PubChem CID 143479803) has the molecular formula C19H16F3N5O and a molecular weight of 387.37 g/mol. Its IUPAC name is (Z)-3-[5-[(4-hydroxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]-N'-[3-(trifluoromethyl)phenyl]prop-2-enimidamide.
| Compound Name | (Z)-3-[5-[(4-hydroxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]-N'-[3-(trifluoromethyl)phenyl]prop-2-enimidamide |
|---|---|
| PubChem CID | 143479803 |
| Molecular Formula | C19H16F3N5O |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (Z)-3-[5-[(4-hydroxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]-N'-[3-(trifluoromethyl)phenyl]prop-2-enimidamide |
| SMILES | NC(/C=C\c1n[nH]c(Cc2ccc(O)cc2)n1)=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N5O/c20-19(21,22)13-2-1-3-14(11-13)24-16(23)8-9-17-25-18(27-26-17)10-12-4-6-15(28)7-5-12/h1-9,11,28H,10H2,(H2,23,24)(H,25,26,27)/b9-8- |
| InChIKey | JMWAWQOUXNOQGW-HJWRWDBZSA-N |
| XLogP | 3.82 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|