C14H16FN — CID 143488506
2-ethenyl-1-(4-fluorophenyl)-N,3-dimethylbut-2-en-1-imine (PubChem CID 143488506) has the molecular formula C14H16FN and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-ethenyl-1-(4-fluorophenyl)-N,3-dimethylbut-2-en-1-imine.
| Compound Name | 2-ethenyl-1-(4-fluorophenyl)-N,3-dimethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 143488506 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-ethenyl-1-(4-fluorophenyl)-N,3-dimethylbut-2-en-1-imine |
| SMILES | C=CC(=C(C)C)/C(=N\C)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FN/c1-5-13(10(2)3)14(16-4)11-6-8-12(15)9-7-11/h5-9H,1H2,2-4H3/b16-14- |
| InChIKey | AYKURLXLNKPFGC-PEZBUJJGSA-N |
| XLogP | 3.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|