C17H13ClF2N2O — CID 163680388
3-amino-2-[C-(4-chlorophenyl)-N-methylcarbonimidoyl]-3-(2,4-difluorophenyl)prop-2-enal (PubChem CID 163680388) has the molecular formula C17H13ClF2N2O and a molecular weight of 334.75 g/mol. Its IUPAC name is 3-amino-2-[C-(4-chlorophenyl)-N-methylcarbonimidoyl]-3-(2,4-difluorophenyl)prop-2-enal.
| Compound Name | 3-amino-2-[C-(4-chlorophenyl)-N-methylcarbonimidoyl]-3-(2,4-difluorophenyl)prop-2-enal |
|---|---|
| PubChem CID | 163680388 |
| Molecular Formula | C17H13ClF2N2O |
| Molecular Weight | 334.75 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-amino-2-[C-(4-chlorophenyl)-N-methylcarbonimidoyl]-3-(2,4-difluorophenyl)prop-2-enal |
| SMILES | C/N=C(/C(C=O)=C(N)c1ccc(F)cc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClF2N2O/c1-22-17(10-2-4-11(18)5-3-10)14(9-23)16(21)13-7-6-12(19)8-15(13)20/h2-9H,21H2,1H3/b16-14?,22-17+ |
| InChIKey | VETCGJMAEQAWAA-DSKRLNAASA-N |
| XLogP | 3.61 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|