C40H70N2O2 — CID 143492831
3-[(3-tert-butyl-5-methylphenyl)methyl]-3-ethenyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)heptan-2-one;4-methoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 143492831) has the molecular formula C40H70N2O2 and a molecular weight of 611.01 g/mol. Its IUPAC name is 3-[(3-tert-butyl-5-methylphenyl)methyl]-3-ethenyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)heptan-2-one;4-methoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 3-[(3-tert-butyl-5-methylphenyl)methyl]-3-ethenyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)heptan-2-one;4-methoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 143492831 |
| Molecular Formula | C40H70N2O2 |
| Molecular Weight | 611.01 g/mol |
| Exact Mass | 610.54 |
| IUPAC Name | 3-[(3-tert-butyl-5-methylphenyl)methyl]-3-ethenyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)heptan-2-one;4-methoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CC(CCCC)(Cc1cc(C)cc(C(C)(C)C)c1)C(=O)CC1CC(C)(C)NC(C)(C)C1.COC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C30H49NO.C10H21NO/c1-11-13-14-30(12-2,21-23-15-22(3)16-25(17-23)27(4,5)6)26(32)18-24-19-28(7,8)31-29(9,10)20-24;1-9(2)6-8(12-5)7-10(3,4)11-9/h12,15-17,24,31H,2,11,13-14,18-21H2,1,3-10H3;8,11H,6-7H2,1-5H3 |
| InChIKey | MIWAXIRMYVJBDF-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.01 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|